About 4-[2-(4-fluorophenyl)sulfonylethyl]-2,2-dimethyl-1,3-dioxolane
4-[2-(4-fluorophenyl)sulfonylethyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 167762727) has the molecular formula C13H17FO4S
and a molecular weight of 288.34 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)sulfonylethyl]-2,2-dimethyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 4-[2-(4-fluorophenyl)sulfonylethyl]-2,2-dimethyl-1,3-dioxolane |
| PubChem CID | 167762727 |
| Molecular Formula | C13H17FO4S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 4-[2-(4-fluorophenyl)sulfonylethyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OCC(CCS(=O)(=O)c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C13H17FO4S/c1-13(2)17-9-11(18-13)7-8-19(15,16)12-5-3-10(14)4-6-12/h3-6,11H,7-9H2,1-2H3 |
| InChIKey | ZOSYIBCFJLDWHF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(4-fluorophenyl)sulfonylethyl]-2,2-dimethyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-fluorophenyl)sulfonylethyl]-2,2-dimethyl-1,3-dioxolane?
The IUPAC name of 4-[2-(4-fluorophenyl)sulfonylethyl]-2,2-dimethyl-1,3-dioxolane (CID 167762727) is 4-[2-(4-fluorophenyl)sulfonylethyl]-2,2-dimethyl-1,3-dioxolane.
What is the SMILES notation for 4-[2-(4-fluorophenyl)sulfonylethyl]-2,2-dimethyl-1,3-dioxolane?
The canonical SMILES for 4-[2-(4-fluorophenyl)sulfonylethyl]-2,2-dimethyl-1,3-dioxolane is CC1(C)OCC(CCS(=O)(=O)c2ccc(F)cc2)O1.
What is the InChIKey of 4-[2-(4-fluorophenyl)sulfonylethyl]-2,2-dimethyl-1,3-dioxolane?
The InChIKey is ZOSYIBCFJLDWHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17FO4S/c1-13(2)17-9-11(18-13)7-8-19(15,16)12-5-3-10(14)4-6-12/h3-6,11H,7-9H2,1-2H3.
What are the key properties of 4-[2-(4-fluorophenyl)sulfonylethyl]-2,2-dimethyl-1,3-dioxolane?
4-[2-(4-fluorophenyl)sulfonylethyl]-2,2-dimethyl-1,3-dioxolane has a molecular weight of 288.34 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-fluorophenyl)sulfonylethyl]-2,2-dimethyl-1,3-dioxolane is sourced from PubChem (CID 167762727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).