About 5-(6-fluoroisoquinolin-3-yl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine
5-(6-fluoroisoquinolin-3-yl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine (PubChem CID 167762807) has the molecular formula C13H11FN4O
and a molecular weight of 258.26 g/mol. Its IUPAC name is 5-(6-fluoroisoquinolin-3-yl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine.
Molecular Properties
| Compound Name | 5-(6-fluoroisoquinolin-3-yl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine |
| PubChem CID | 167762807 |
| Molecular Formula | C13H11FN4O |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 5-(6-fluoroisoquinolin-3-yl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine |
| SMILES | CN(C)c1noc(-c2cc3cc(F)ccc3cn2)n1 |
| InChI | InChI=1S/C13H11FN4O/c1-18(2)13-16-12(19-17-13)11-6-9-5-10(14)4-3-8(9)7-15-11/h3-7H,1-2H3 |
| InChIKey | SIUPFAIVUWEHAV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(6-fluoroisoquinolin-3-yl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-fluoroisoquinolin-3-yl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine?
The IUPAC name of 5-(6-fluoroisoquinolin-3-yl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine (CID 167762807) is 5-(6-fluoroisoquinolin-3-yl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine.
What is the SMILES notation for 5-(6-fluoroisoquinolin-3-yl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine?
The canonical SMILES for 5-(6-fluoroisoquinolin-3-yl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine is CN(C)c1noc(-c2cc3cc(F)ccc3cn2)n1.
What is the InChIKey of 5-(6-fluoroisoquinolin-3-yl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine?
The InChIKey is SIUPFAIVUWEHAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11FN4O/c1-18(2)13-16-12(19-17-13)11-6-9-5-10(14)4-3-8(9)7-15-11/h3-7H,1-2H3.
What are the key properties of 5-(6-fluoroisoquinolin-3-yl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine?
5-(6-fluoroisoquinolin-3-yl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine has a molecular weight of 258.26 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-fluoroisoquinolin-3-yl)-N,N-dimethyl-1,2,4-oxadiazol-3-amine is sourced from PubChem (CID 167762807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).