C14H19F3N6O2 — CID 167762960
4-[5-[(2R,5S)-5-[(dimethylamino)methyl]oxolan-2-yl]-1,2,4-oxadiazol-3-yl]-1-(2,2,2-trifluoroethyl)pyrazol-3-amine (PubChem CID 167762960) has the molecular formula C14H19F3N6O2 and a molecular weight of 360.34 g/mol. Its IUPAC name is 4-[5-[(2R,5S)-5-[(dimethylamino)methyl]oxolan-2-yl]-1,2,4-oxadiazol-3-yl]-1-(2,2,2-trifluoroethyl)pyrazol-3-amine.
| Compound Name | 4-[5-[(2R,5S)-5-[(dimethylamino)methyl]oxolan-2-yl]-1,2,4-oxadiazol-3-yl]-1-(2,2,2-trifluoroethyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 167762960 |
| Molecular Formula | C14H19F3N6O2 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 4-[5-[(2R,5S)-5-[(dimethylamino)methyl]oxolan-2-yl]-1,2,4-oxadiazol-3-yl]-1-(2,2,2-trifluoroethyl)pyrazol-3-amine |
| SMILES | CN(C)C[C@@H]1CC[C@H](c2nc(-c3cn(CC(F)(F)F)nc3N)no2)O1 |
| InChI | InChI=1S/C14H19F3N6O2/c1-22(2)5-8-3-4-10(24-8)13-19-12(21-25-13)9-6-23(20-11(9)18)7-14(15,16)17/h6,8,10H,3-5,7H2,1-2H3,(H2,18,20)/t8-,10+/m0/s1 |
| InChIKey | XTMOYTHRNBRYBX-WCBMZHEXSA-N |
| XLogP | 1.86 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |