About [5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane
[5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane (PubChem CID 167763290) has the molecular formula C12H16N4O2S
and a molecular weight of 280.35 g/mol. Its IUPAC name is [5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane.
Molecular Properties
| Compound Name | [5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane |
| PubChem CID | 167763290 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | [5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane |
| SMILES | COc1ccccc1Cc1nc(N=S(C)(C)=O)n[nH]1 |
| InChI | InChI=1S/C12H16N4O2S/c1-18-10-7-5-4-6-9(10)8-11-13-12(15-14-11)16-19(2,3)17/h4-7H,8H2,1-3H3,(H,13,14,15) |
| InChIKey | PEXOQHBJRLMJKO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane?
The IUPAC name of [5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane (CID 167763290) is [5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane.
What is the SMILES notation for [5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane?
The canonical SMILES for [5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane is COc1ccccc1Cc1nc(N=S(C)(C)=O)n[nH]1.
What is the InChIKey of [5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane?
The InChIKey is PEXOQHBJRLMJKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O2S/c1-18-10-7-5-4-6-9(10)8-11-13-12(15-14-11)16-19(2,3)17/h4-7H,8H2,1-3H3,(H,13,14,15).
What are the key properties of [5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane?
[5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane has a molecular weight of 280.35 g/mol, XLogP of 1.76, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(2-methoxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]imino-dimethyl-oxo-λ6-sulfane is sourced from PubChem (CID 167763290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).