C13H16F3N5O2 — CID 167763611
4-(imidazol-1-ylmethyl)-1-(2-methylidenebutyl)triazole;2,2,2-trifluoroacetic acid (PubChem CID 167763611) has the molecular formula C13H16F3N5O2 and a molecular weight of 331.30 g/mol. Its IUPAC name is 4-(imidazol-1-ylmethyl)-1-(2-methylidenebutyl)triazole;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(imidazol-1-ylmethyl)-1-(2-methylidenebutyl)triazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167763611 |
| Molecular Formula | C13H16F3N5O2 |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 4-(imidazol-1-ylmethyl)-1-(2-methylidenebutyl)triazole;2,2,2-trifluoroacetic acid |
| SMILES | C=C(CC)Cn1cc(Cn2ccnc2)nn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H15N5.C2HF3O2/c1-3-10(2)6-16-8-11(13-14-16)7-15-5-4-12-9-15;3-2(4,5)1(6)7/h4-5,8-9H,2-3,6-7H2,1H3;(H,6,7) |
| InChIKey | HWADXAYKMPFLEK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|