C18H17N5O3 — CID 167763759
5-(1,3-benzodioxol-5-yl)-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-1H-pyrazole-4-carboxamide (PubChem CID 167763759) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 167763759 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-1H-pyrazole-4-carboxamide |
| SMILES | C#CCCC1(CCNC(=O)c2cn[nH]c2-c2ccc3c(c2)OCO3)N=N1 |
| InChI | InChI=1S/C18H17N5O3/c1-2-3-6-18(22-23-18)7-8-19-17(24)13-10-20-21-16(13)12-4-5-14-15(9-12)26-11-25-14/h1,4-5,9-10H,3,6-8,11H2,(H,19,24)(H,20,21) |
| InChIKey | ZGZKADICAZJXBK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|