C19H18F4N2O5 — CID 167763894
4-[[4-(3-fluoro-2-nitrophenyl)phenyl]methyl]morpholine;2,2,2-trifluoroacetic acid (PubChem CID 167763894) has the molecular formula C19H18F4N2O5 and a molecular weight of 430.35 g/mol. Its IUPAC name is 4-[[4-(3-fluoro-2-nitrophenyl)phenyl]methyl]morpholine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[4-(3-fluoro-2-nitrophenyl)phenyl]methyl]morpholine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167763894 |
| Molecular Formula | C19H18F4N2O5 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-[[4-(3-fluoro-2-nitrophenyl)phenyl]methyl]morpholine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=[N+]([O-])c1c(F)cccc1-c1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C17H17FN2O3.C2HF3O2/c18-16-3-1-2-15(17(16)20(21)22)14-6-4-13(5-7-14)12-19-8-10-23-11-9-19;3-2(4,5)1(6)7/h1-7H,8-12H2;(H,6,7) |
| InChIKey | IZNGFKPWHWFZDN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|