About 2-(3-aminophenoxy)-N,N-diethylacetamide
2-(3-aminophenoxy)-N,N-diethylacetamide (PubChem CID 16776391) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-(3-aminophenoxy)-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-(3-aminophenoxy)-N,N-diethylacetamide |
| PubChem CID | 16776391 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-(3-aminophenoxy)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)COc1cccc(N)c1 |
| InChI | InChI=1S/C12H18N2O2/c1-3-14(4-2)12(15)9-16-11-7-5-6-10(13)8-11/h5-8H,3-4,9,13H2,1-2H3 |
| InChIKey | VXFQVHSRMJKAFB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-aminophenoxy)-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminophenoxy)-N,N-diethylacetamide?
The IUPAC name of 2-(3-aminophenoxy)-N,N-diethylacetamide (CID 16776391) is 2-(3-aminophenoxy)-N,N-diethylacetamide.
What is the SMILES notation for 2-(3-aminophenoxy)-N,N-diethylacetamide?
The canonical SMILES for 2-(3-aminophenoxy)-N,N-diethylacetamide is CCN(CC)C(=O)COc1cccc(N)c1.
What is the InChIKey of 2-(3-aminophenoxy)-N,N-diethylacetamide?
The InChIKey is VXFQVHSRMJKAFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-3-14(4-2)12(15)9-16-11-7-5-6-10(13)8-11/h5-8H,3-4,9,13H2,1-2H3.
What are the key properties of 2-(3-aminophenoxy)-N,N-diethylacetamide?
2-(3-aminophenoxy)-N,N-diethylacetamide has a molecular weight of 222.29 g/mol, XLogP of 1.52, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminophenoxy)-N,N-diethylacetamide is sourced from PubChem (CID 16776391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).