C15H12Cl2N2O3S — CID 167764718
N-[4-chloro-3-[(2-chlorophenyl)sulfamoyl]phenyl]prop-2-enamide (PubChem CID 167764718) has the molecular formula C15H12Cl2N2O3S and a molecular weight of 371.25 g/mol. Its IUPAC name is N-[4-chloro-3-[(2-chlorophenyl)sulfamoyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-chloro-3-[(2-chlorophenyl)sulfamoyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 167764718 |
| Molecular Formula | C15H12Cl2N2O3S |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | N-[4-chloro-3-[(2-chlorophenyl)sulfamoyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(Cl)c(S(=O)(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C15H12Cl2N2O3S/c1-2-15(20)18-10-7-8-12(17)14(9-10)23(21,22)19-13-6-4-3-5-11(13)16/h2-9,19H,1H2,(H,18,20) |
| InChIKey | YHFJURZHBXJMNO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|