C22H29Cl2N5O3 — CID 167764875
1-(3,4-dichlorophenyl)-2-oxo-N-[(2R)-2-[4-(1-propan-2-yloxypropan-2-yl)triazol-1-yl]propyl]pyrrolidine-3-carboxamide (PubChem CID 167764875) has the molecular formula C22H29Cl2N5O3 and a molecular weight of 482.41 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-oxo-N-[(2R)-2-[4-(1-propan-2-yloxypropan-2-yl)triazol-1-yl]propyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(3,4-dichlorophenyl)-2-oxo-N-[(2R)-2-[4-(1-propan-2-yloxypropan-2-yl)triazol-1-yl]propyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 167764875 |
| Molecular Formula | C22H29Cl2N5O3 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-oxo-N-[(2R)-2-[4-(1-propan-2-yloxypropan-2-yl)triazol-1-yl]propyl]pyrrolidine-3-carboxamide |
| SMILES | CC(C)OCC(C)c1cn([C@H](C)CNC(=O)C2CCN(c3ccc(Cl)c(Cl)c3)C2=O)nn1 |
| InChI | InChI=1S/C22H29Cl2N5O3/c1-13(2)32-12-14(3)20-11-29(27-26-20)15(4)10-25-21(30)17-7-8-28(22(17)31)16-5-6-18(23)19(24)9-16/h5-6,9,11,13-15,17H,7-8,10,12H2,1-4H3,(H,25,30)/t14?,15-,17?/m1/s1 |
| InChIKey | VOKYVWCQACKNSX-ISXOHVOVSA-N |
| XLogP | 3.84 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|