C17H12Cl2N2O — CID 16776490
N-(2-amino-4,6-dichlorophenyl)naphthalene-2-carboxamide (PubChem CID 16776490) has the molecular formula C17H12Cl2N2O and a molecular weight of 331.20 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)naphthalene-2-carboxamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 16776490 |
| Molecular Formula | C17H12Cl2N2O |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)naphthalene-2-carboxamide |
| SMILES | Nc1cc(Cl)cc(Cl)c1NC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H12Cl2N2O/c18-13-8-14(19)16(15(20)9-13)21-17(22)12-6-5-10-3-1-2-4-11(10)7-12/h1-9H,20H2,(H,21,22) |
| InChIKey | ZCVOMTKRLANUQM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|