C15H18N4O3 — CID 167765151
(5S)-5-[2-(4-methyl-3,5-dihydro-2H-1,4-benzodiazepin-1-yl)-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 167765151) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is (5S)-5-[2-(4-methyl-3,5-dihydro-2H-1,4-benzodiazepin-1-yl)-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[2-(4-methyl-3,5-dihydro-2H-1,4-benzodiazepin-1-yl)-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 167765151 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (5S)-5-[2-(4-methyl-3,5-dihydro-2H-1,4-benzodiazepin-1-yl)-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | CN1CCN(C(=O)C[C@@H]2NC(=O)NC2=O)c2ccccc2C1 |
| InChI | InChI=1S/C15H18N4O3/c1-18-6-7-19(12-5-3-2-4-10(12)9-18)13(20)8-11-14(21)17-15(22)16-11/h2-5,11H,6-9H2,1H3,(H2,16,17,21,22)/t11-/m0/s1 |
| InChIKey | MPFKHGSMHPQVMF-NSHDSACASA-N |
| XLogP | 0.06 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|