C16H16BrN3O4 — CID 167765714
6-[4-(5-bromo-3-methylfuran-2-carbonyl)piperazin-1-yl]pyridine-3-carboxylic acid (PubChem CID 167765714) has the molecular formula C16H16BrN3O4 and a molecular weight of 394.23 g/mol. Its IUPAC name is 6-[4-(5-bromo-3-methylfuran-2-carbonyl)piperazin-1-yl]pyridine-3-carboxylic acid.
| Compound Name | 6-[4-(5-bromo-3-methylfuran-2-carbonyl)piperazin-1-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 167765714 |
| Molecular Formula | C16H16BrN3O4 |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 6-[4-(5-bromo-3-methylfuran-2-carbonyl)piperazin-1-yl]pyridine-3-carboxylic acid |
| SMILES | Cc1cc(Br)oc1C(=O)N1CCN(c2ccc(C(=O)O)cn2)CC1 |
| InChI | InChI=1S/C16H16BrN3O4/c1-10-8-12(17)24-14(10)15(21)20-6-4-19(5-7-20)13-3-2-11(9-18-13)16(22)23/h2-3,8-9H,4-7H2,1H3,(H,22,23) |
| InChIKey | VHHZVIYPFNYSML-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |