C12H11F3N4O2S — CID 167765768
N-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-6-ylmethyl)-5-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 167765768) has the molecular formula C12H11F3N4O2S and a molecular weight of 332.31 g/mol. Its IUPAC name is N-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-6-ylmethyl)-5-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-6-ylmethyl)-5-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 167765768 |
| Molecular Formula | C12H11F3N4O2S |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | N-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-6-ylmethyl)-5-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | FC(F)(F)Cc1nnc(NCc2ccc3c(n2)OCCO3)s1 |
| InChI | InChI=1S/C12H11F3N4O2S/c13-12(14,15)5-9-18-19-11(22-9)16-6-7-1-2-8-10(17-7)21-4-3-20-8/h1-2H,3-6H2,(H,16,19) |
| InChIKey | QHZONMFQVYEPPN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |