About (4-chloro-2-cyanophenyl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate
(4-chloro-2-cyanophenyl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate (PubChem CID 167766080) has the molecular formula C16H11ClN4O2
and a molecular weight of 326.74 g/mol. Its IUPAC name is (4-chloro-2-cyanophenyl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | (4-chloro-2-cyanophenyl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate |
| PubChem CID | 167766080 |
| Molecular Formula | C16H11ClN4O2 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | (4-chloro-2-cyanophenyl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate |
| SMILES | Cn1cnc2cc(C(=O)OCc3ccc(Cl)cc3C#N)cnc21 |
| InChI | InChI=1S/C16H11ClN4O2/c1-21-9-20-14-5-12(7-19-15(14)21)16(22)23-8-10-2-3-13(17)4-11(10)6-18/h2-5,7,9H,8H2,1H3 |
| InChIKey | FDOORIAGFHUWIA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 80.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-chloro-2-cyanophenyl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-2-cyanophenyl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate?
The IUPAC name of (4-chloro-2-cyanophenyl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate (CID 167766080) is (4-chloro-2-cyanophenyl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate.
What is the SMILES notation for (4-chloro-2-cyanophenyl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate?
The canonical SMILES for (4-chloro-2-cyanophenyl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate is Cn1cnc2cc(C(=O)OCc3ccc(Cl)cc3C#N)cnc21.
What is the InChIKey of (4-chloro-2-cyanophenyl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate?
The InChIKey is FDOORIAGFHUWIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClN4O2/c1-21-9-20-14-5-12(7-19-15(14)21)16(22)23-8-10-2-3-13(17)4-11(10)6-18/h2-5,7,9H,8H2,1H3.
What are the key properties of (4-chloro-2-cyanophenyl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate?
(4-chloro-2-cyanophenyl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate has a molecular weight of 326.74 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-2-cyanophenyl)methyl 3-methylimidazo[4,5-b]pyridine-6-carboxylate is sourced from PubChem (CID 167766080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).