About ethyl 1-(2,5-difluoro-4-methylphenyl)sulfonyl-3-prop-2-enylpyrrolidine-3-carboxylate
ethyl 1-(2,5-difluoro-4-methylphenyl)sulfonyl-3-prop-2-enylpyrrolidine-3-carboxylate (PubChem CID 167766735) has the molecular formula C17H21F2NO4S
and a molecular weight of 373.42 g/mol. Its IUPAC name is ethyl 1-(2,5-difluoro-4-methylphenyl)sulfonyl-3-prop-2-enylpyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(2,5-difluoro-4-methylphenyl)sulfonyl-3-prop-2-enylpyrrolidine-3-carboxylate |
| PubChem CID | 167766735 |
| Molecular Formula | C17H21F2NO4S |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | ethyl 1-(2,5-difluoro-4-methylphenyl)sulfonyl-3-prop-2-enylpyrrolidine-3-carboxylate |
| SMILES | C=CCC1(C(=O)OCC)CCN(S(=O)(=O)c2cc(F)c(C)cc2F)C1 |
| InChI | InChI=1S/C17H21F2NO4S/c1-4-6-17(16(21)24-5-2)7-8-20(11-17)25(22,23)15-10-13(18)12(3)9-14(15)19/h4,9-10H,1,5-8,11H2,2-3H3 |
| InChIKey | ORNJXSMXLKOKBQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-(2,5-difluoro-4-methylphenyl)sulfonyl-3-prop-2-enylpyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(2,5-difluoro-4-methylphenyl)sulfonyl-3-prop-2-enylpyrrolidine-3-carboxylate?
The IUPAC name of ethyl 1-(2,5-difluoro-4-methylphenyl)sulfonyl-3-prop-2-enylpyrrolidine-3-carboxylate (CID 167766735) is ethyl 1-(2,5-difluoro-4-methylphenyl)sulfonyl-3-prop-2-enylpyrrolidine-3-carboxylate.
What is the SMILES notation for ethyl 1-(2,5-difluoro-4-methylphenyl)sulfonyl-3-prop-2-enylpyrrolidine-3-carboxylate?
The canonical SMILES for ethyl 1-(2,5-difluoro-4-methylphenyl)sulfonyl-3-prop-2-enylpyrrolidine-3-carboxylate is C=CCC1(C(=O)OCC)CCN(S(=O)(=O)c2cc(F)c(C)cc2F)C1.
What is the InChIKey of ethyl 1-(2,5-difluoro-4-methylphenyl)sulfonyl-3-prop-2-enylpyrrolidine-3-carboxylate?
The InChIKey is ORNJXSMXLKOKBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F2NO4S/c1-4-6-17(16(21)24-5-2)7-8-20(11-17)25(22,23)15-10-13(18)12(3)9-14(15)19/h4,9-10H,1,5-8,11H2,2-3H3.
What are the key properties of ethyl 1-(2,5-difluoro-4-methylphenyl)sulfonyl-3-prop-2-enylpyrrolidine-3-carboxylate?
ethyl 1-(2,5-difluoro-4-methylphenyl)sulfonyl-3-prop-2-enylpyrrolidine-3-carboxylate has a molecular weight of 373.42 g/mol, XLogP of 2.79, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(2,5-difluoro-4-methylphenyl)sulfonyl-3-prop-2-enylpyrrolidine-3-carboxylate is sourced from PubChem (CID 167766735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).