About 4-ethylsulfanyl-2,6-dimethylpyrimidine-5-carboxylic acid
4-ethylsulfanyl-2,6-dimethylpyrimidine-5-carboxylic acid (PubChem CID 16776765) has the molecular formula C9H12N2O2S
and a molecular weight of 212.27 g/mol. Its IUPAC name is 4-ethylsulfanyl-2,6-dimethylpyrimidine-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-ethylsulfanyl-2,6-dimethylpyrimidine-5-carboxylic acid |
| PubChem CID | 16776765 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 4-ethylsulfanyl-2,6-dimethylpyrimidine-5-carboxylic acid |
| SMILES | CCSc1nc(C)nc(C)c1C(=O)O |
| InChI | InChI=1S/C9H12N2O2S/c1-4-14-8-7(9(12)13)5(2)10-6(3)11-8/h4H2,1-3H3,(H,12,13) |
| InChIKey | BQNGOQAJPGLUJG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethylsulfanyl-2,6-dimethylpyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylsulfanyl-2,6-dimethylpyrimidine-5-carboxylic acid?
The IUPAC name of 4-ethylsulfanyl-2,6-dimethylpyrimidine-5-carboxylic acid (CID 16776765) is 4-ethylsulfanyl-2,6-dimethylpyrimidine-5-carboxylic acid.
What is the SMILES notation for 4-ethylsulfanyl-2,6-dimethylpyrimidine-5-carboxylic acid?
The canonical SMILES for 4-ethylsulfanyl-2,6-dimethylpyrimidine-5-carboxylic acid is CCSc1nc(C)nc(C)c1C(=O)O.
What is the InChIKey of 4-ethylsulfanyl-2,6-dimethylpyrimidine-5-carboxylic acid?
The InChIKey is BQNGOQAJPGLUJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S/c1-4-14-8-7(9(12)13)5(2)10-6(3)11-8/h4H2,1-3H3,(H,12,13).
What are the key properties of 4-ethylsulfanyl-2,6-dimethylpyrimidine-5-carboxylic acid?
4-ethylsulfanyl-2,6-dimethylpyrimidine-5-carboxylic acid has a molecular weight of 212.27 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylsulfanyl-2,6-dimethylpyrimidine-5-carboxylic acid is sourced from PubChem (CID 16776765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).