C11H14N4O2S — CID 16776773
1,3-dimethyl-7-propan-2-yl-5-sulfanylidene-8H-pyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 16776773) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 1,3-dimethyl-7-propan-2-yl-5-sulfanylidene-8H-pyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-7-propan-2-yl-5-sulfanylidene-8H-pyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 16776773 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 1,3-dimethyl-7-propan-2-yl-5-sulfanylidene-8H-pyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | CC(C)c1nc(=S)c2c(=O)n(C)c(=O)n(C)c2[nH]1 |
| InChI | InChI=1S/C11H14N4O2S/c1-5(2)7-12-8-6(9(18)13-7)10(16)15(4)11(17)14(8)3/h5H,1-4H3,(H,12,13,18) |
| InChIKey | NYMSOEPKDCFRTL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|