About N-[(5-cyclopropyl-1,3-oxazol-4-yl)methyl]ethenesulfonamide
N-[(5-cyclopropyl-1,3-oxazol-4-yl)methyl]ethenesulfonamide (PubChem CID 167768215) has the molecular formula C9H12N2O3S
and a molecular weight of 228.27 g/mol. Its IUPAC name is N-[(5-cyclopropyl-1,3-oxazol-4-yl)methyl]ethenesulfonamide.
Molecular Properties
| Compound Name | N-[(5-cyclopropyl-1,3-oxazol-4-yl)methyl]ethenesulfonamide |
| PubChem CID | 167768215 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | N-[(5-cyclopropyl-1,3-oxazol-4-yl)methyl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)NCc1ncoc1C1CC1 |
| InChI | InChI=1S/C9H12N2O3S/c1-2-15(12,13)11-5-8-9(7-3-4-7)14-6-10-8/h2,6-7,11H,1,3-5H2 |
| InChIKey | YJMGMHLCGANLSN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(5-cyclopropyl-1,3-oxazol-4-yl)methyl]ethenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-cyclopropyl-1,3-oxazol-4-yl)methyl]ethenesulfonamide?
The IUPAC name of N-[(5-cyclopropyl-1,3-oxazol-4-yl)methyl]ethenesulfonamide (CID 167768215) is N-[(5-cyclopropyl-1,3-oxazol-4-yl)methyl]ethenesulfonamide.
What is the SMILES notation for N-[(5-cyclopropyl-1,3-oxazol-4-yl)methyl]ethenesulfonamide?
The canonical SMILES for N-[(5-cyclopropyl-1,3-oxazol-4-yl)methyl]ethenesulfonamide is C=CS(=O)(=O)NCc1ncoc1C1CC1.
What is the InChIKey of N-[(5-cyclopropyl-1,3-oxazol-4-yl)methyl]ethenesulfonamide?
The InChIKey is YJMGMHLCGANLSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3S/c1-2-15(12,13)11-5-8-9(7-3-4-7)14-6-10-8/h2,6-7,11H,1,3-5H2.
What are the key properties of N-[(5-cyclopropyl-1,3-oxazol-4-yl)methyl]ethenesulfonamide?
N-[(5-cyclopropyl-1,3-oxazol-4-yl)methyl]ethenesulfonamide has a molecular weight of 228.27 g/mol, XLogP of 1.11, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-cyclopropyl-1,3-oxazol-4-yl)methyl]ethenesulfonamide is sourced from PubChem (CID 167768215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).