C18H26N2O4 — CID 167768600
5-[2-(2-propan-2-ylphenoxy)ethylcarbamoyl]piperidine-2-carboxylic acid (PubChem CID 167768600) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 5-[2-(2-propan-2-ylphenoxy)ethylcarbamoyl]piperidine-2-carboxylic acid.
| Compound Name | 5-[2-(2-propan-2-ylphenoxy)ethylcarbamoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 167768600 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 5-[2-(2-propan-2-ylphenoxy)ethylcarbamoyl]piperidine-2-carboxylic acid |
| SMILES | CC(C)c1ccccc1OCCNC(=O)C1CCC(C(=O)O)NC1 |
| InChI | InChI=1S/C18H26N2O4/c1-12(2)14-5-3-4-6-16(14)24-10-9-19-17(21)13-7-8-15(18(22)23)20-11-13/h3-6,12-13,15,20H,7-11H2,1-2H3,(H,19,21)(H,22,23) |
| InChIKey | XZTRQTCHXULTRS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|