About propan-2-yl 2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetate
propan-2-yl 2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetate (PubChem CID 16776892) has the molecular formula C9H12ClNO2S
and a molecular weight of 233.72 g/mol. Its IUPAC name is propan-2-yl 2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetate.
Molecular Properties
| Compound Name | propan-2-yl 2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetate |
| PubChem CID | 16776892 |
| Molecular Formula | C9H12ClNO2S |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | propan-2-yl 2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetate |
| SMILES | CC(C)OC(=O)Cc1nc(CCl)cs1 |
| InChI | InChI=1S/C9H12ClNO2S/c1-6(2)13-9(12)3-8-11-7(4-10)5-14-8/h5-6H,3-4H2,1-2H3 |
| InChIKey | LHYDYCXHUPTVDM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetate?
The IUPAC name of propan-2-yl 2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetate (CID 16776892) is propan-2-yl 2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetate.
What is the SMILES notation for propan-2-yl 2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetate?
The canonical SMILES for propan-2-yl 2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetate is CC(C)OC(=O)Cc1nc(CCl)cs1.
What is the InChIKey of propan-2-yl 2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetate?
The InChIKey is LHYDYCXHUPTVDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClNO2S/c1-6(2)13-9(12)3-8-11-7(4-10)5-14-8/h5-6H,3-4H2,1-2H3.
What are the key properties of propan-2-yl 2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetate?
propan-2-yl 2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetate has a molecular weight of 233.72 g/mol, XLogP of 2.38, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[4-(chloromethyl)-1,3-thiazol-2-yl]acetate is sourced from PubChem (CID 16776892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).