About 1-(2,4-dimethylphenyl)-N-methylethanamine
1-(2,4-dimethylphenyl)-N-methylethanamine (PubChem CID 16776999) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-N-methylethanamine.
Molecular Properties
| Compound Name | 1-(2,4-dimethylphenyl)-N-methylethanamine |
| PubChem CID | 16776999 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-N-methylethanamine |
| SMILES | CNC(C)c1ccc(C)cc1C |
| InChI | InChI=1S/C11H17N/c1-8-5-6-11(9(2)7-8)10(3)12-4/h5-7,10,12H,1-4H3 |
| InChIKey | XTNFDYBRUMIEEW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2,4-dimethylphenyl)-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dimethylphenyl)-N-methylethanamine?
The IUPAC name of 1-(2,4-dimethylphenyl)-N-methylethanamine (CID 16776999) is 1-(2,4-dimethylphenyl)-N-methylethanamine.
What is the SMILES notation for 1-(2,4-dimethylphenyl)-N-methylethanamine?
The canonical SMILES for 1-(2,4-dimethylphenyl)-N-methylethanamine is CNC(C)c1ccc(C)cc1C.
What is the InChIKey of 1-(2,4-dimethylphenyl)-N-methylethanamine?
The InChIKey is XTNFDYBRUMIEEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-8-5-6-11(9(2)7-8)10(3)12-4/h5-7,10,12H,1-4H3.
What are the key properties of 1-(2,4-dimethylphenyl)-N-methylethanamine?
1-(2,4-dimethylphenyl)-N-methylethanamine has a molecular weight of 163.26 g/mol, XLogP of 2.58, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dimethylphenyl)-N-methylethanamine is sourced from PubChem (CID 16776999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).