C16H15N3O5 — CID 167770682
3-[(5-methoxy-2-methyl-1-benzofuran-3-carbonyl)amino]-1-methylpyrazole-5-carboxylic acid (PubChem CID 167770682) has the molecular formula C16H15N3O5 and a molecular weight of 329.31 g/mol. Its IUPAC name is 3-[(5-methoxy-2-methyl-1-benzofuran-3-carbonyl)amino]-1-methylpyrazole-5-carboxylic acid.
| Compound Name | 3-[(5-methoxy-2-methyl-1-benzofuran-3-carbonyl)amino]-1-methylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 167770682 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 3-[(5-methoxy-2-methyl-1-benzofuran-3-carbonyl)amino]-1-methylpyrazole-5-carboxylic acid |
| SMILES | COc1ccc2oc(C)c(C(=O)Nc3cc(C(=O)O)n(C)n3)c2c1 |
| InChI | InChI=1S/C16H15N3O5/c1-8-14(10-6-9(23-3)4-5-12(10)24-8)15(20)17-13-7-11(16(21)22)19(2)18-13/h4-7H,1-3H3,(H,21,22)(H,17,18,20) |
| InChIKey | ULCKUKTWZXAHMH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |