About 1-(1-oxo-2,3-dihydroisoindol-4-yl)-3-(2-propylpyrazol-3-yl)urea
1-(1-oxo-2,3-dihydroisoindol-4-yl)-3-(2-propylpyrazol-3-yl)urea (PubChem CID 167770760) has the molecular formula C15H17N5O2
and a molecular weight of 299.33 g/mol. Its IUPAC name is 1-(1-oxo-2,3-dihydroisoindol-4-yl)-3-(2-propylpyrazol-3-yl)urea.
Molecular Properties
| Compound Name | 1-(1-oxo-2,3-dihydroisoindol-4-yl)-3-(2-propylpyrazol-3-yl)urea |
| PubChem CID | 167770760 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-(1-oxo-2,3-dihydroisoindol-4-yl)-3-(2-propylpyrazol-3-yl)urea |
| SMILES | CCCn1nccc1NC(=O)Nc1cccc2c1CNC2=O |
| InChI | InChI=1S/C15H17N5O2/c1-2-8-20-13(6-7-17-20)19-15(22)18-12-5-3-4-10-11(12)9-16-14(10)21/h3-7H,2,8-9H2,1H3,(H,16,21)(H2,18,19,22) |
| InChIKey | FASRYUIDOKAZAT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1-oxo-2,3-dihydroisoindol-4-yl)-3-(2-propylpyrazol-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-oxo-2,3-dihydroisoindol-4-yl)-3-(2-propylpyrazol-3-yl)urea?
The IUPAC name of 1-(1-oxo-2,3-dihydroisoindol-4-yl)-3-(2-propylpyrazol-3-yl)urea (CID 167770760) is 1-(1-oxo-2,3-dihydroisoindol-4-yl)-3-(2-propylpyrazol-3-yl)urea.
What is the SMILES notation for 1-(1-oxo-2,3-dihydroisoindol-4-yl)-3-(2-propylpyrazol-3-yl)urea?
The canonical SMILES for 1-(1-oxo-2,3-dihydroisoindol-4-yl)-3-(2-propylpyrazol-3-yl)urea is CCCn1nccc1NC(=O)Nc1cccc2c1CNC2=O.
What is the InChIKey of 1-(1-oxo-2,3-dihydroisoindol-4-yl)-3-(2-propylpyrazol-3-yl)urea?
The InChIKey is FASRYUIDOKAZAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5O2/c1-2-8-20-13(6-7-17-20)19-15(22)18-12-5-3-4-10-11(12)9-16-14(10)21/h3-7H,2,8-9H2,1H3,(H,16,21)(H2,18,19,22).
What are the key properties of 1-(1-oxo-2,3-dihydroisoindol-4-yl)-3-(2-propylpyrazol-3-yl)urea?
1-(1-oxo-2,3-dihydroisoindol-4-yl)-3-(2-propylpyrazol-3-yl)urea has a molecular weight of 299.33 g/mol, XLogP of 2.18, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-oxo-2,3-dihydroisoindol-4-yl)-3-(2-propylpyrazol-3-yl)urea is sourced from PubChem (CID 167770760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).