C15H14FN5O2 — CID 167770762
2-(6-fluoro-1-benzofuran-3-yl)-1-[2-(2H-tetrazol-5-yl)pyrrolidin-1-yl]ethanone (PubChem CID 167770762) has the molecular formula C15H14FN5O2 and a molecular weight of 315.31 g/mol. Its IUPAC name is 2-(6-fluoro-1-benzofuran-3-yl)-1-[2-(2H-tetrazol-5-yl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(6-fluoro-1-benzofuran-3-yl)-1-[2-(2H-tetrazol-5-yl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 167770762 |
| Molecular Formula | C15H14FN5O2 |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-(6-fluoro-1-benzofuran-3-yl)-1-[2-(2H-tetrazol-5-yl)pyrrolidin-1-yl]ethanone |
| SMILES | O=C(Cc1coc2cc(F)ccc12)N1CCCC1c1nn[nH]n1 |
| InChI | InChI=1S/C15H14FN5O2/c16-10-3-4-11-9(8-23-13(11)7-10)6-14(22)21-5-1-2-12(21)15-17-19-20-18-15/h3-4,7-8,12H,1-2,5-6H2,(H,17,18,19,20) |
| InChIKey | VCXTXSAXTZUVKP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |