About 2-fluoro-N-[(3S,4R)-4-pyrazol-1-yloxolan-3-yl]prop-2-enamide
2-fluoro-N-[(3S,4R)-4-pyrazol-1-yloxolan-3-yl]prop-2-enamide (PubChem CID 167770939) has the molecular formula C10H12FN3O2
and a molecular weight of 225.22 g/mol. Its IUPAC name is 2-fluoro-N-[(3S,4R)-4-pyrazol-1-yloxolan-3-yl]prop-2-enamide.
Molecular Properties
| Compound Name | 2-fluoro-N-[(3S,4R)-4-pyrazol-1-yloxolan-3-yl]prop-2-enamide |
| PubChem CID | 167770939 |
| Molecular Formula | C10H12FN3O2 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 2-fluoro-N-[(3S,4R)-4-pyrazol-1-yloxolan-3-yl]prop-2-enamide |
| SMILES | C=C(F)C(=O)N[C@@H]1COC[C@@H]1n1cccn1 |
| InChI | InChI=1S/C10H12FN3O2/c1-7(11)10(15)13-8-5-16-6-9(8)14-4-2-3-12-14/h2-4,8-9H,1,5-6H2,(H,13,15)/t8-,9+/m1/s1 |
| InChIKey | HUCJDQUCXZKASH-BDAKNGLRSA-N |
| XLogP | 0.42 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N-[(3S,4R)-4-pyrazol-1-yloxolan-3-yl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-[(3S,4R)-4-pyrazol-1-yloxolan-3-yl]prop-2-enamide?
The IUPAC name of 2-fluoro-N-[(3S,4R)-4-pyrazol-1-yloxolan-3-yl]prop-2-enamide (CID 167770939) is 2-fluoro-N-[(3S,4R)-4-pyrazol-1-yloxolan-3-yl]prop-2-enamide.
What is the SMILES notation for 2-fluoro-N-[(3S,4R)-4-pyrazol-1-yloxolan-3-yl]prop-2-enamide?
The canonical SMILES for 2-fluoro-N-[(3S,4R)-4-pyrazol-1-yloxolan-3-yl]prop-2-enamide is C=C(F)C(=O)N[C@@H]1COC[C@@H]1n1cccn1.
What is the InChIKey of 2-fluoro-N-[(3S,4R)-4-pyrazol-1-yloxolan-3-yl]prop-2-enamide?
The InChIKey is HUCJDQUCXZKASH-BDAKNGLRSA-N. The full InChI is InChI=1S/C10H12FN3O2/c1-7(11)10(15)13-8-5-16-6-9(8)14-4-2-3-12-14/h2-4,8-9H,1,5-6H2,(H,13,15)/t8-,9+/m1/s1.
What are the key properties of 2-fluoro-N-[(3S,4R)-4-pyrazol-1-yloxolan-3-yl]prop-2-enamide?
2-fluoro-N-[(3S,4R)-4-pyrazol-1-yloxolan-3-yl]prop-2-enamide has a molecular weight of 225.22 g/mol, XLogP of 0.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-[(3S,4R)-4-pyrazol-1-yloxolan-3-yl]prop-2-enamide is sourced from PubChem (CID 167770939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).