C12H14ClFN2O3S — CID 167771217
(3S,3aS,6aR)-5-(3-chloro-5-fluoro-4-pyridinyl)-3-methoxy-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide (PubChem CID 167771217) has the molecular formula C12H14ClFN2O3S and a molecular weight of 320.77 g/mol. Its IUPAC name is (3S,3aS,6aR)-5-(3-chloro-5-fluoro-4-pyridinyl)-3-methoxy-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide.
| Compound Name | (3S,3aS,6aR)-5-(3-chloro-5-fluoro-4-pyridinyl)-3-methoxy-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide |
|---|---|
| PubChem CID | 167771217 |
| Molecular Formula | C12H14ClFN2O3S |
| Molecular Weight | 320.77 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | (3S,3aS,6aR)-5-(3-chloro-5-fluoro-4-pyridinyl)-3-methoxy-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrole 1,1-dioxide |
| SMILES | CO[C@@H]1CS(=O)(=O)[C@H]2CN(c3c(F)cncc3Cl)C[C@@H]12 |
| InChI | InChI=1S/C12H14ClFN2O3S/c1-19-10-6-20(17,18)11-5-16(4-7(10)11)12-8(13)2-15-3-9(12)14/h2-3,7,10-11H,4-6H2,1H3/t7-,10+,11-/m0/s1 |
| InChIKey | OJDYGJOHDVKMJQ-XROYCOCOSA-N |
| XLogP | 1.12 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.77 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |