C14H10N4O2S — CID 167771781
2-[3-(1,2-oxazol-5-ylmethyl)-1,2,4-oxadiazol-5-yl]-1-benzothiophen-5-amine (PubChem CID 167771781) has the molecular formula C14H10N4O2S and a molecular weight of 298.33 g/mol. Its IUPAC name is 2-[3-(1,2-oxazol-5-ylmethyl)-1,2,4-oxadiazol-5-yl]-1-benzothiophen-5-amine.
| Compound Name | 2-[3-(1,2-oxazol-5-ylmethyl)-1,2,4-oxadiazol-5-yl]-1-benzothiophen-5-amine |
|---|---|
| PubChem CID | 167771781 |
| Molecular Formula | C14H10N4O2S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 2-[3-(1,2-oxazol-5-ylmethyl)-1,2,4-oxadiazol-5-yl]-1-benzothiophen-5-amine |
| SMILES | Nc1ccc2sc(-c3nc(Cc4ccno4)no3)cc2c1 |
| InChI | InChI=1S/C14H10N4O2S/c15-9-1-2-11-8(5-9)6-12(21-11)14-17-13(18-20-14)7-10-3-4-16-19-10/h1-6H,7,15H2 |
| InChIKey | MVQUWVUXDWBYAB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|