About 1-[(2R,4S)-4-fluoro-2-(trifluoromethyl)pyrrolidin-1-yl]prop-2-en-1-one
1-[(2R,4S)-4-fluoro-2-(trifluoromethyl)pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 167772125) has the molecular formula C8H9F4NO
and a molecular weight of 211.16 g/mol. Its IUPAC name is 1-[(2R,4S)-4-fluoro-2-(trifluoromethyl)pyrrolidin-1-yl]prop-2-en-1-one.
Molecular Properties
| Compound Name | 1-[(2R,4S)-4-fluoro-2-(trifluoromethyl)pyrrolidin-1-yl]prop-2-en-1-one |
| PubChem CID | 167772125 |
| Molecular Formula | C8H9F4NO |
| Molecular Weight | 211.16 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 1-[(2R,4S)-4-fluoro-2-(trifluoromethyl)pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@@H](F)C[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C8H9F4NO/c1-2-7(14)13-4-5(9)3-6(13)8(10,11)12/h2,5-6H,1,3-4H2/t5-,6+/m0/s1 |
| InChIKey | LSWQKIMHVYZOAA-NTSWFWBYSA-N |
| XLogP | 1.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.16 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2R,4S)-4-fluoro-2-(trifluoromethyl)pyrrolidin-1-yl]prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R,4S)-4-fluoro-2-(trifluoromethyl)pyrrolidin-1-yl]prop-2-en-1-one?
The IUPAC name of 1-[(2R,4S)-4-fluoro-2-(trifluoromethyl)pyrrolidin-1-yl]prop-2-en-1-one (CID 167772125) is 1-[(2R,4S)-4-fluoro-2-(trifluoromethyl)pyrrolidin-1-yl]prop-2-en-1-one.
What is the SMILES notation for 1-[(2R,4S)-4-fluoro-2-(trifluoromethyl)pyrrolidin-1-yl]prop-2-en-1-one?
The canonical SMILES for 1-[(2R,4S)-4-fluoro-2-(trifluoromethyl)pyrrolidin-1-yl]prop-2-en-1-one is C=CC(=O)N1C[C@@H](F)C[C@@H]1C(F)(F)F.
What is the InChIKey of 1-[(2R,4S)-4-fluoro-2-(trifluoromethyl)pyrrolidin-1-yl]prop-2-en-1-one?
The InChIKey is LSWQKIMHVYZOAA-NTSWFWBYSA-N. The full InChI is InChI=1S/C8H9F4NO/c1-2-7(14)13-4-5(9)3-6(13)8(10,11)12/h2,5-6H,1,3-4H2/t5-,6+/m0/s1.
What are the key properties of 1-[(2R,4S)-4-fluoro-2-(trifluoromethyl)pyrrolidin-1-yl]prop-2-en-1-one?
1-[(2R,4S)-4-fluoro-2-(trifluoromethyl)pyrrolidin-1-yl]prop-2-en-1-one has a molecular weight of 211.16 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R,4S)-4-fluoro-2-(trifluoromethyl)pyrrolidin-1-yl]prop-2-en-1-one is sourced from PubChem (CID 167772125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).