C17H20N2O5 — CID 167772979
2-[2-[[(3S)-3-methoxypyrrolidine-1-carbonyl]amino]ethyl]-1-benzofuran-6-carboxylic acid (PubChem CID 167772979) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-[2-[[(3S)-3-methoxypyrrolidine-1-carbonyl]amino]ethyl]-1-benzofuran-6-carboxylic acid.
| Compound Name | 2-[2-[[(3S)-3-methoxypyrrolidine-1-carbonyl]amino]ethyl]-1-benzofuran-6-carboxylic acid |
|---|---|
| PubChem CID | 167772979 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-[2-[[(3S)-3-methoxypyrrolidine-1-carbonyl]amino]ethyl]-1-benzofuran-6-carboxylic acid |
| SMILES | CO[C@H]1CCN(C(=O)NCCc2cc3ccc(C(=O)O)cc3o2)C1 |
| InChI | InChI=1S/C17H20N2O5/c1-23-14-5-7-19(10-14)17(22)18-6-4-13-8-11-2-3-12(16(20)21)9-15(11)24-13/h2-3,8-9,14H,4-7,10H2,1H3,(H,18,22)(H,20,21)/t14-/m0/s1 |
| InChIKey | IQLKVHIBABDRKW-AWEZNQCLSA-N |
| XLogP | 2.10 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |