C20H22N4O4 — CID 167773270
N'-[3-(5-methyl-1,3-oxazol-2-yl)phenyl]-N-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)oxamide (PubChem CID 167773270) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is N'-[3-(5-methyl-1,3-oxazol-2-yl)phenyl]-N-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)oxamide.
| Compound Name | N'-[3-(5-methyl-1,3-oxazol-2-yl)phenyl]-N-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)oxamide |
|---|---|
| PubChem CID | 167773270 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N'-[3-(5-methyl-1,3-oxazol-2-yl)phenyl]-N-(3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl)oxamide |
| SMILES | Cc1cnc(-c2cccc(NC(=O)C(=O)NC3CC(=O)N4CCCCC34)c2)o1 |
| InChI | InChI=1S/C20H22N4O4/c1-12-11-21-20(28-12)13-5-4-6-14(9-13)22-18(26)19(27)23-15-10-17(25)24-8-3-2-7-16(15)24/h4-6,9,11,15-16H,2-3,7-8,10H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | ONFVZASPCNYYAK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|