C20H27N7O2 — CID 167774410
N-[(3R,4R)-4-methyl-1-[6-methyl-2-(methylamino)pyrimidine-4-carbonyl]pyrrolidin-3-yl]-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide (PubChem CID 167774410) has the molecular formula C20H27N7O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[(3R,4R)-4-methyl-1-[6-methyl-2-(methylamino)pyrimidine-4-carbonyl]pyrrolidin-3-yl]-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide.
| Compound Name | N-[(3R,4R)-4-methyl-1-[6-methyl-2-(methylamino)pyrimidine-4-carbonyl]pyrrolidin-3-yl]-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide |
|---|---|
| PubChem CID | 167774410 |
| Molecular Formula | C20H27N7O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | N-[(3R,4R)-4-methyl-1-[6-methyl-2-(methylamino)pyrimidine-4-carbonyl]pyrrolidin-3-yl]-4,5,6,7-tetrahydro-1H-indazole-7-carboxamide |
| SMILES | CNc1nc(C)cc(C(=O)N2C[C@@H](C)[C@@H](NC(=O)C3CCCc4cn[nH]c43)C2)n1 |
| InChI | InChI=1S/C20H27N7O2/c1-11-9-27(19(29)15-7-12(2)23-20(21-3)25-15)10-16(11)24-18(28)14-6-4-5-13-8-22-26-17(13)14/h7-8,11,14,16H,4-6,9-10H2,1-3H3,(H,22,26)(H,24,28)(H,21,23,25)/t11-,14?,16+/m1/s1 |
| InChIKey | JPCQWIKWLRSCOP-DMPVCAQSSA-N |
| XLogP | 1.25 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |