About 2-(4,4-difluorocyclohexyl)-2-[(8-methoxy-2-methylquinolin-4-yl)amino]ethanol
2-(4,4-difluorocyclohexyl)-2-[(8-methoxy-2-methylquinolin-4-yl)amino]ethanol (PubChem CID 167774460) has the molecular formula C19H24F2N2O2
and a molecular weight of 350.41 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexyl)-2-[(8-methoxy-2-methylquinolin-4-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-(4,4-difluorocyclohexyl)-2-[(8-methoxy-2-methylquinolin-4-yl)amino]ethanol |
| PubChem CID | 167774460 |
| Molecular Formula | C19H24F2N2O2 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-(4,4-difluorocyclohexyl)-2-[(8-methoxy-2-methylquinolin-4-yl)amino]ethanol |
| SMILES | COc1cccc2c(NC(CO)C3CCC(F)(F)CC3)cc(C)nc12 |
| InChI | InChI=1S/C19H24F2N2O2/c1-12-10-15(14-4-3-5-17(25-2)18(14)22-12)23-16(11-24)13-6-8-19(20,21)9-7-13/h3-5,10,13,16,24H,6-9,11H2,1-2H3,(H,22,23) |
| InChIKey | SBJQOQRIGDYMOD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,4-difluorocyclohexyl)-2-[(8-methoxy-2-methylquinolin-4-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluorocyclohexyl)-2-[(8-methoxy-2-methylquinolin-4-yl)amino]ethanol?
The IUPAC name of 2-(4,4-difluorocyclohexyl)-2-[(8-methoxy-2-methylquinolin-4-yl)amino]ethanol (CID 167774460) is 2-(4,4-difluorocyclohexyl)-2-[(8-methoxy-2-methylquinolin-4-yl)amino]ethanol.
What is the SMILES notation for 2-(4,4-difluorocyclohexyl)-2-[(8-methoxy-2-methylquinolin-4-yl)amino]ethanol?
The canonical SMILES for 2-(4,4-difluorocyclohexyl)-2-[(8-methoxy-2-methylquinolin-4-yl)amino]ethanol is COc1cccc2c(NC(CO)C3CCC(F)(F)CC3)cc(C)nc12.
What is the InChIKey of 2-(4,4-difluorocyclohexyl)-2-[(8-methoxy-2-methylquinolin-4-yl)amino]ethanol?
The InChIKey is SBJQOQRIGDYMOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24F2N2O2/c1-12-10-15(14-4-3-5-17(25-2)18(14)22-12)23-16(11-24)13-6-8-19(20,21)9-7-13/h3-5,10,13,16,24H,6-9,11H2,1-2H3,(H,22,23).
What are the key properties of 2-(4,4-difluorocyclohexyl)-2-[(8-methoxy-2-methylquinolin-4-yl)amino]ethanol?
2-(4,4-difluorocyclohexyl)-2-[(8-methoxy-2-methylquinolin-4-yl)amino]ethanol has a molecular weight of 350.41 g/mol, XLogP of 4.15, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluorocyclohexyl)-2-[(8-methoxy-2-methylquinolin-4-yl)amino]ethanol is sourced from PubChem (CID 167774460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).