C20H28N6O — CID 167774780
N-[[4-(piperazin-1-ylmethyl)phenyl]methyl]-5-pyrrolidin-3-yl-1H-pyrazole-4-carboxamide (PubChem CID 167774780) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is N-[[4-(piperazin-1-ylmethyl)phenyl]methyl]-5-pyrrolidin-3-yl-1H-pyrazole-4-carboxamide.
| Compound Name | N-[[4-(piperazin-1-ylmethyl)phenyl]methyl]-5-pyrrolidin-3-yl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 167774780 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | N-[[4-(piperazin-1-ylmethyl)phenyl]methyl]-5-pyrrolidin-3-yl-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NCc1ccc(CN2CCNCC2)cc1)c1cn[nH]c1C1CCNC1 |
| InChI | InChI=1S/C20H28N6O/c27-20(18-13-24-25-19(18)17-5-6-22-12-17)23-11-15-1-3-16(4-2-15)14-26-9-7-21-8-10-26/h1-4,13,17,21-22H,5-12,14H2,(H,23,27)(H,24,25) |
| InChIKey | ZZCXCELNOKXFFF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |