2-(5-ethyl-2,3-dioxoindol-1-yl)acetic acid

C12H11NO4 — CID 16777501

IUPAC2-(5-ethyl-2,3-dioxoindol-1-yl)acetic acid
SMILESCCc1ccc2c(c1)C(=O)C(=O)N2CC(=O)O
InChIInChI=1S/C12H11NO4/c1-2-7-3-4-9-8(5-7)11(16)12(17)13(9)6-10(14)15/h3-5H,2,6H2,1H3,(H,14,15)
InChIKeyFWOZWOSEGWGXMY-UHFFFAOYSA-N
MW233.22 g/mol
LogP0.86
Rot. Bonds3

About 2-(5-ethyl-2,3-dioxoindol-1-yl)acetic acid

2-(5-ethyl-2,3-dioxoindol-1-yl)acetic acid (PubChem CID 16777501) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 2-(5-ethyl-2,3-dioxoindol-1-yl)acetic acid.

Molecular Properties

Compound Name2-(5-ethyl-2,3-dioxoindol-1-yl)acetic acid
PubChem CID16777501
Molecular FormulaC12H11NO4
Molecular Weight233.22 g/mol
Exact Mass233.07
IUPAC Name2-(5-ethyl-2,3-dioxoindol-1-yl)acetic acid
SMILESCCc1ccc2c(c1)C(=O)C(=O)N2CC(=O)O
InChIInChI=1S/C12H11NO4/c1-2-7-3-4-9-8(5-7)11(16)12(17)13(9)6-10(14)15/h3-5H,2,6H2,1H3,(H,14,15)
InChIKeyFWOZWOSEGWGXMY-UHFFFAOYSA-N
XLogP0.86
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.22
LogP ≤ 50.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-(5-ethyl-2,3-dioxoindol-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-ethyl-2,3-dioxoindol-1-yl)acetic acid?
The IUPAC name of 2-(5-ethyl-2,3-dioxoindol-1-yl)acetic acid (CID 16777501) is 2-(5-ethyl-2,3-dioxoindol-1-yl)acetic acid.
What is the SMILES notation for 2-(5-ethyl-2,3-dioxoindol-1-yl)acetic acid?
The canonical SMILES for 2-(5-ethyl-2,3-dioxoindol-1-yl)acetic acid is CCc1ccc2c(c1)C(=O)C(=O)N2CC(=O)O.
What is the InChIKey of 2-(5-ethyl-2,3-dioxoindol-1-yl)acetic acid?
The InChIKey is FWOZWOSEGWGXMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO4/c1-2-7-3-4-9-8(5-7)11(16)12(17)13(9)6-10(14)15/h3-5H,2,6H2,1H3,(H,14,15).
What are the key properties of 2-(5-ethyl-2,3-dioxoindol-1-yl)acetic acid?
2-(5-ethyl-2,3-dioxoindol-1-yl)acetic acid has a molecular weight of 233.22 g/mol, XLogP of 0.86, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-ethyl-2,3-dioxoindol-1-yl)acetic acid is sourced from PubChem (CID 16777501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).