C15H20N4O3S — CID 16777555
7-(cyclopentylmethyl)-1-(2-methoxyethyl)-5-sulfanylidene-8H-pyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 16777555) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is 7-(cyclopentylmethyl)-1-(2-methoxyethyl)-5-sulfanylidene-8H-pyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 7-(cyclopentylmethyl)-1-(2-methoxyethyl)-5-sulfanylidene-8H-pyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 16777555 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 7-(cyclopentylmethyl)-1-(2-methoxyethyl)-5-sulfanylidene-8H-pyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | COCCn1c(=O)[nH]c(=O)c2c(=S)nc(CC3CCCC3)[nH]c21 |
| InChI | InChI=1S/C15H20N4O3S/c1-22-7-6-19-12-11(13(20)18-15(19)21)14(23)17-10(16-12)8-9-4-2-3-5-9/h9H,2-8H2,1H3,(H,16,17,23)(H,18,20,21) |
| InChIKey | WJGPNZDIMFEDQN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 92.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|