About 3-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]thiophene-2-sulfonamide
3-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]thiophene-2-sulfonamide (PubChem CID 167776525) has the molecular formula C10H13N3O3S2
and a molecular weight of 287.37 g/mol. Its IUPAC name is 3-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 3-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]thiophene-2-sulfonamide |
| PubChem CID | 167776525 |
| Molecular Formula | C10H13N3O3S2 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 3-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]thiophene-2-sulfonamide |
| SMILES | Cc1cc(CNCc2ccsc2S(N)(=O)=O)no1 |
| InChI | InChI=1S/C10H13N3O3S2/c1-7-4-9(13-16-7)6-12-5-8-2-3-17-10(8)18(11,14)15/h2-4,12H,5-6H2,1H3,(H2,11,14,15) |
| InChIKey | NSUJQZAPWHOXTN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]thiophene-2-sulfonamide?
The IUPAC name of 3-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]thiophene-2-sulfonamide (CID 167776525) is 3-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]thiophene-2-sulfonamide.
What is the SMILES notation for 3-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]thiophene-2-sulfonamide?
The canonical SMILES for 3-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]thiophene-2-sulfonamide is Cc1cc(CNCc2ccsc2S(N)(=O)=O)no1.
What is the InChIKey of 3-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]thiophene-2-sulfonamide?
The InChIKey is NSUJQZAPWHOXTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O3S2/c1-7-4-9(13-16-7)6-12-5-8-2-3-17-10(8)18(11,14)15/h2-4,12H,5-6H2,1H3,(H2,11,14,15).
What are the key properties of 3-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]thiophene-2-sulfonamide?
3-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]thiophene-2-sulfonamide has a molecular weight of 287.37 g/mol, XLogP of 0.98, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]thiophene-2-sulfonamide is sourced from PubChem (CID 167776525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).