C18H17N3O2 — CID 167776784
1-[4-(2,3-dihydro-1H-indol-5-yl)phenyl]-1,3-diazinane-2,4-dione (PubChem CID 167776784) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 1-[4-(2,3-dihydro-1H-indol-5-yl)phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[4-(2,3-dihydro-1H-indol-5-yl)phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 167776784 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 1-[4-(2,3-dihydro-1H-indol-5-yl)phenyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2ccc(-c3ccc4c(c3)CCN4)cc2)C(=O)N1 |
| InChI | InChI=1S/C18H17N3O2/c22-17-8-10-21(18(23)20-17)15-4-1-12(2-5-15)13-3-6-16-14(11-13)7-9-19-16/h1-6,11,19H,7-10H2,(H,20,22,23) |
| InChIKey | BQWBNWQNBDXICX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |