C16H20N4O3 — CID 167778492
[(3aS,6aR)-3a-(hydroxymethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-1-yl]-[5-(triazol-1-ylmethyl)furan-2-yl]methanone (PubChem CID 167778492) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is [(3aS,6aR)-3a-(hydroxymethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-1-yl]-[5-(triazol-1-ylmethyl)furan-2-yl]methanone.
| Compound Name | [(3aS,6aR)-3a-(hydroxymethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-1-yl]-[5-(triazol-1-ylmethyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 167778492 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | [(3aS,6aR)-3a-(hydroxymethyl)-2,3,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-1-yl]-[5-(triazol-1-ylmethyl)furan-2-yl]methanone |
| SMILES | O=C(c1ccc(Cn2ccnn2)o1)N1CC[C@@]2(CO)CCC[C@@H]12 |
| InChI | InChI=1S/C16H20N4O3/c21-11-16-5-1-2-14(16)20(8-6-16)15(22)13-4-3-12(23-13)10-19-9-7-17-18-19/h3-4,7,9,14,21H,1-2,5-6,8,10-11H2/t14-,16-/m1/s1 |
| InChIKey | WPVPWMQDHALZRD-GDBMZVCRSA-N |
| XLogP | 1.30 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |