C14H24N2O6S — CID 167778953
2-(2-hydroxyethylsulfonyl)-N-[(3R)-1-(oxane-4-carbonyl)pyrrolidin-3-yl]acetamide (PubChem CID 167778953) has the molecular formula C14H24N2O6S and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-(2-hydroxyethylsulfonyl)-N-[(3R)-1-(oxane-4-carbonyl)pyrrolidin-3-yl]acetamide.
| Compound Name | 2-(2-hydroxyethylsulfonyl)-N-[(3R)-1-(oxane-4-carbonyl)pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 167778953 |
| Molecular Formula | C14H24N2O6S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-(2-hydroxyethylsulfonyl)-N-[(3R)-1-(oxane-4-carbonyl)pyrrolidin-3-yl]acetamide |
| SMILES | O=C(CS(=O)(=O)CCO)N[C@@H]1CCN(C(=O)C2CCOCC2)C1 |
| InChI | InChI=1S/C14H24N2O6S/c17-5-8-23(20,21)10-13(18)15-12-1-4-16(9-12)14(19)11-2-6-22-7-3-11/h11-12,17H,1-10H2,(H,15,18)/t12-/m1/s1 |
| InChIKey | BMQULBOKEHLSTA-GFCCVEGCSA-N |
| XLogP | -1.46 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |