About 1-[1-[(2,3-difluoro-4-pyridinyl)methyl]triazol-4-yl]-2-methylpropan-1-ol
1-[1-[(2,3-difluoro-4-pyridinyl)methyl]triazol-4-yl]-2-methylpropan-1-ol (PubChem CID 167779041) has the molecular formula C12H14F2N4O
and a molecular weight of 268.27 g/mol. Its IUPAC name is 1-[1-[(2,3-difluoro-4-pyridinyl)methyl]triazol-4-yl]-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 1-[1-[(2,3-difluoro-4-pyridinyl)methyl]triazol-4-yl]-2-methylpropan-1-ol |
| PubChem CID | 167779041 |
| Molecular Formula | C12H14F2N4O |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-[1-[(2,3-difluoro-4-pyridinyl)methyl]triazol-4-yl]-2-methylpropan-1-ol |
| SMILES | CC(C)C(O)c1cn(Cc2ccnc(F)c2F)nn1 |
| InChI | InChI=1S/C12H14F2N4O/c1-7(2)11(19)9-6-18(17-16-9)5-8-3-4-15-12(14)10(8)13/h3-4,6-7,11,19H,5H2,1-2H3 |
| InChIKey | MHAWVCPEFOOGHA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-[(2,3-difluoro-4-pyridinyl)methyl]triazol-4-yl]-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(2,3-difluoro-4-pyridinyl)methyl]triazol-4-yl]-2-methylpropan-1-ol?
The IUPAC name of 1-[1-[(2,3-difluoro-4-pyridinyl)methyl]triazol-4-yl]-2-methylpropan-1-ol (CID 167779041) is 1-[1-[(2,3-difluoro-4-pyridinyl)methyl]triazol-4-yl]-2-methylpropan-1-ol.
What is the SMILES notation for 1-[1-[(2,3-difluoro-4-pyridinyl)methyl]triazol-4-yl]-2-methylpropan-1-ol?
The canonical SMILES for 1-[1-[(2,3-difluoro-4-pyridinyl)methyl]triazol-4-yl]-2-methylpropan-1-ol is CC(C)C(O)c1cn(Cc2ccnc(F)c2F)nn1.
What is the InChIKey of 1-[1-[(2,3-difluoro-4-pyridinyl)methyl]triazol-4-yl]-2-methylpropan-1-ol?
The InChIKey is MHAWVCPEFOOGHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2N4O/c1-7(2)11(19)9-6-18(17-16-9)5-8-3-4-15-12(14)10(8)13/h3-4,6-7,11,19H,5H2,1-2H3.
What are the key properties of 1-[1-[(2,3-difluoro-4-pyridinyl)methyl]triazol-4-yl]-2-methylpropan-1-ol?
1-[1-[(2,3-difluoro-4-pyridinyl)methyl]triazol-4-yl]-2-methylpropan-1-ol has a molecular weight of 268.27 g/mol, XLogP of 1.69, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(2,3-difluoro-4-pyridinyl)methyl]triazol-4-yl]-2-methylpropan-1-ol is sourced from PubChem (CID 167779041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).