C24H17N2NaO5S — CID 167779353
sodium 2-methyl-5-[10-(methylamino)-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-14-yl]benzenesulfonate (PubChem CID 167779353) has the molecular formula C24H17N2NaO5S and a molecular weight of 468.47 g/mol. Its IUPAC name is sodium 2-methyl-5-[10-(methylamino)-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-14-yl]benzenesulfonate.
| Compound Name | sodium 2-methyl-5-[10-(methylamino)-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-14-yl]benzenesulfonate |
|---|---|
| PubChem CID | 167779353 |
| Molecular Formula | C24H17N2NaO5S |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | sodium 2-methyl-5-[10-(methylamino)-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-14-yl]benzenesulfonate |
| SMILES | CNc1ccc2c3c(cc(=O)n2-c2ccc(C)c(S(=O)(=O)[O-])c2)-c2ccccc2C(=O)c13.[Na+] |
| InChI | InChI=1S/C24H18N2O5S.Na/c1-13-7-8-14(11-20(13)32(29,30)31)26-19-10-9-18(25-2)23-22(19)17(12-21(26)27)15-5-3-4-6-16(15)24(23)28;/h3-12,25H,1-2H3,(H,29,30,31);/q;+1/p-1 |
| InChIKey | ZENBFMPQQLLLHH-UHFFFAOYSA-M |
| XLogP | 0.46 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|