C14H17N5O2 — CID 167779490
[(3aR,7aS)-7a-amino-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-imidazo[1,2-a]pyrazin-8-ylmethanone (PubChem CID 167779490) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is [(3aR,7aS)-7a-amino-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-imidazo[1,2-a]pyrazin-8-ylmethanone.
| Compound Name | [(3aR,7aS)-7a-amino-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-imidazo[1,2-a]pyrazin-8-ylmethanone |
|---|---|
| PubChem CID | 167779490 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | [(3aR,7aS)-7a-amino-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-imidazo[1,2-a]pyrazin-8-ylmethanone |
| SMILES | N[C@@]12CCOC[C@@H]1CN(C(=O)c1nccn3ccnc13)C2 |
| InChI | InChI=1S/C14H17N5O2/c15-14-1-6-21-8-10(14)7-19(9-14)13(20)11-12-17-3-5-18(12)4-2-16-11/h2-5,10H,1,6-9,15H2/t10-,14+/m0/s1 |
| InChIKey | JJIRUTJSEYCXAF-IINYFYTJSA-N |
| XLogP | -0.08 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |