C16H18N2O2S — CID 167779770
2-cyclopentyloxy-N-(2-methyl-1,3-thiazol-5-yl)benzamide (PubChem CID 167779770) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-cyclopentyloxy-N-(2-methyl-1,3-thiazol-5-yl)benzamide.
| Compound Name | 2-cyclopentyloxy-N-(2-methyl-1,3-thiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 167779770 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-cyclopentyloxy-N-(2-methyl-1,3-thiazol-5-yl)benzamide |
| SMILES | Cc1ncc(NC(=O)c2ccccc2OC2CCCC2)s1 |
| InChI | InChI=1S/C16H18N2O2S/c1-11-17-10-15(21-11)18-16(19)13-8-4-5-9-14(13)20-12-6-2-3-7-12/h4-5,8-10,12H,2-3,6-7H2,1H3,(H,18,19) |
| InChIKey | XUIKKMXYOZEOFG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |