About 1-[4-[(1,3-benzoxazol-2-ylamino)methyl]triazol-1-yl]butan-2-ol
1-[4-[(1,3-benzoxazol-2-ylamino)methyl]triazol-1-yl]butan-2-ol (PubChem CID 167780197) has the molecular formula C14H17N5O2
and a molecular weight of 287.32 g/mol. Its IUPAC name is 1-[4-[(1,3-benzoxazol-2-ylamino)methyl]triazol-1-yl]butan-2-ol.
Molecular Properties
| Compound Name | 1-[4-[(1,3-benzoxazol-2-ylamino)methyl]triazol-1-yl]butan-2-ol |
| PubChem CID | 167780197 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 1-[4-[(1,3-benzoxazol-2-ylamino)methyl]triazol-1-yl]butan-2-ol |
| SMILES | CCC(O)Cn1cc(CNc2nc3ccccc3o2)nn1 |
| InChI | InChI=1S/C14H17N5O2/c1-2-11(20)9-19-8-10(17-18-19)7-15-14-16-12-5-3-4-6-13(12)21-14/h3-6,8,11,20H,2,7,9H2,1H3,(H,15,16) |
| InChIKey | LAXJLGMQBFSMLQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[4-[(1,3-benzoxazol-2-ylamino)methyl]triazol-1-yl]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(1,3-benzoxazol-2-ylamino)methyl]triazol-1-yl]butan-2-ol?
The IUPAC name of 1-[4-[(1,3-benzoxazol-2-ylamino)methyl]triazol-1-yl]butan-2-ol (CID 167780197) is 1-[4-[(1,3-benzoxazol-2-ylamino)methyl]triazol-1-yl]butan-2-ol.
What is the SMILES notation for 1-[4-[(1,3-benzoxazol-2-ylamino)methyl]triazol-1-yl]butan-2-ol?
The canonical SMILES for 1-[4-[(1,3-benzoxazol-2-ylamino)methyl]triazol-1-yl]butan-2-ol is CCC(O)Cn1cc(CNc2nc3ccccc3o2)nn1.
What is the InChIKey of 1-[4-[(1,3-benzoxazol-2-ylamino)methyl]triazol-1-yl]butan-2-ol?
The InChIKey is LAXJLGMQBFSMLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5O2/c1-2-11(20)9-19-8-10(17-18-19)7-15-14-16-12-5-3-4-6-13(12)21-14/h3-6,8,11,20H,2,7,9H2,1H3,(H,15,16).
What are the key properties of 1-[4-[(1,3-benzoxazol-2-ylamino)methyl]triazol-1-yl]butan-2-ol?
1-[4-[(1,3-benzoxazol-2-ylamino)methyl]triazol-1-yl]butan-2-ol has a molecular weight of 287.32 g/mol, XLogP of 1.80, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(1,3-benzoxazol-2-ylamino)methyl]triazol-1-yl]butan-2-ol is sourced from PubChem (CID 167780197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).