C9H10ClN3O2 — CID 16778185
2-amino-N-(2-amino-2-oxoethyl)-5-chlorobenzamide (PubChem CID 16778185) has the molecular formula C9H10ClN3O2 and a molecular weight of 227.65 g/mol. Its IUPAC name is 2-amino-N-(2-amino-2-oxoethyl)-5-chlorobenzamide.
| Compound Name | 2-amino-N-(2-amino-2-oxoethyl)-5-chlorobenzamide |
|---|---|
| PubChem CID | 16778185 |
| Molecular Formula | C9H10ClN3O2 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 2-amino-N-(2-amino-2-oxoethyl)-5-chlorobenzamide |
| SMILES | NC(=O)CNC(=O)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C9H10ClN3O2/c10-5-1-2-7(11)6(3-5)9(15)13-4-8(12)14/h1-3H,4,11H2,(H2,12,14)(H,13,15) |
| InChIKey | IQIMDWJZWKBEFS-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|