C9H19N — CID 16778202
N,2,6-trimethylcyclohexan-1-amine (PubChem CID 16778202) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is N,2,6-trimethylcyclohexan-1-amine.
| Compound Name | N,2,6-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 16778202 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | N,2,6-trimethylcyclohexan-1-amine |
| SMILES | CNC1C(C)CCCC1C |
| InChI | InChI=1S/C9H19N/c1-7-5-4-6-8(2)9(7)10-3/h7-10H,4-6H2,1-3H3 |
| InChIKey | BWVAXYOVGQELNQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |