C9H8ClFO3 — CID 16778332
3-(2-chloro-4-fluorophenoxy)propanoic acid (PubChem CID 16778332) has the molecular formula C9H8ClFO3 and a molecular weight of 218.61 g/mol. Its IUPAC name is 3-(2-chloro-4-fluorophenoxy)propanoic acid.
| Compound Name | 3-(2-chloro-4-fluorophenoxy)propanoic acid |
|---|---|
| PubChem CID | 16778332 |
| Molecular Formula | C9H8ClFO3 |
| Molecular Weight | 218.61 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | 3-(2-chloro-4-fluorophenoxy)propanoic acid |
| SMILES | O=C(O)CCOc1ccc(F)cc1Cl |
| InChI | InChI=1S/C9H8ClFO3/c10-7-5-6(11)1-2-8(7)14-4-3-9(12)13/h1-2,5H,3-4H2,(H,12,13) |
| InChIKey | XNBUXUDYENDIRW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.61 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |