C14H13N3O5 — CID 167783555
4-[(2-methoxycarbonyl-5-methyl-1H-pyrrol-3-yl)carbamoyl]pyridine-2-carboxylic acid (PubChem CID 167783555) has the molecular formula C14H13N3O5 and a molecular weight of 303.27 g/mol. Its IUPAC name is 4-[(2-methoxycarbonyl-5-methyl-1H-pyrrol-3-yl)carbamoyl]pyridine-2-carboxylic acid.
| Compound Name | 4-[(2-methoxycarbonyl-5-methyl-1H-pyrrol-3-yl)carbamoyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 167783555 |
| Molecular Formula | C14H13N3O5 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 4-[(2-methoxycarbonyl-5-methyl-1H-pyrrol-3-yl)carbamoyl]pyridine-2-carboxylic acid |
| SMILES | COC(=O)c1[nH]c(C)cc1NC(=O)c1ccnc(C(=O)O)c1 |
| InChI | InChI=1S/C14H13N3O5/c1-7-5-9(11(16-7)14(21)22-2)17-12(18)8-3-4-15-10(6-8)13(19)20/h3-6,16H,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | JLUGHMBQOLOYTN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |