C19H29N3O3 — CID 167784148
tert-butyl 3-hex-5-enyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate (PubChem CID 167784148) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is tert-butyl 3-hex-5-enyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate.
| Compound Name | tert-butyl 3-hex-5-enyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate |
|---|---|
| PubChem CID | 167784148 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | tert-butyl 3-hex-5-enyl-4-oxo-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carboxylate |
| SMILES | C=CCCCCn1cnc2c(c1=O)CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C19H29N3O3/c1-5-6-7-8-11-22-14-20-16-10-13-21(12-9-15(16)17(22)23)18(24)25-19(2,3)4/h5,14H,1,6-13H2,2-4H3 |
| InChIKey | PWGYQAFYRLEJIH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|